(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate ^{الإنجليزية} (Q1525307)

group of stereoisomers ^{الإنجليزية}

اللغة	التسمية	الوصف	أسماء أخرى
العربية	لم تُضف التسمية	لا يوجد وصف
الإنجليزية	(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate	group of stereoisomers

بيانات

Wikidata item ^{الإنجليزية}

٠ مرجع

subclass of ^{الإنجليزية}

polyatomic cation ^{الإنجليزية}

١ مراجع

monocation ^{الإنجليزية}

١ مراجع

canonical SMILES ^{الإنجليزية}

CC(C)[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C

١ مراجع

instance of ^{الإنجليزية}

١ مراجع

chemical formula ^{الإنجليزية}

[C₂₀H₃₀NO₃]+

١ مراجع

mass ^{الإنجليزية}

٣٣٢٫٤٥٧٩ وحدة كتل ذرية

١ مراجع