7-{4-[anilino(oxo)methyl]-2-(4-fluorophenyl)-3-phenyl-5-propan-2-yl-1-pyrrolyl}-3,5-dihydroxyheptanoic acid الإنجليزية (Q227458)
group of stereoisomers الإنجليزية
| اللغة | التسمية | الوصف | أسماء أخرى |
|---|---|---|---|
| العربية | لم تُضف التسمية |
لا يوجد وصف |
|
| الإنجليزية | 7-{4-[anilino(oxo)methyl]-2-(4-fluorophenyl)-3-phenyl-5-propan-2-yl-1-pyrrolyl}-3,5-dihydroxyheptanoic acid |
group of stereoisomers |
بيانات
Wikidata item الإنجليزية
instance of الإنجليزية
chemical formula الإنجليزية
mass الإنجليزية
canonical SMILES الإنجليزية
CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4
١ مراجع
Imported from Wikidata item الإنجليزية
UNII الإنجليزية
DSSTox substance ID الإنجليزية
subclass of الإنجليزية