(3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenyl-4-piperidinecarboxylic acid الإنجليزية (Q3206371)
group of stereoisomers الإنجليزية
اللغة | التسمية | الوصف | أسماء أخرى |
---|---|---|---|
العربية | لم تُضف التسمية |
لا يوجد وصف |
|
الإنجليزية | (3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenyl-4-piperidinecarboxylic acid |
group of stereoisomers |
بيانات
Wikidata item الإنجليزية
instance of الإنجليزية
chemical formula الإنجليزية
mass الإنجليزية
isomeric SMILES الإنجليزية
C[C@@H]1CN(CC[C@@]1(C2=CC=CC=C2)C(=O)O)C3CCC(CC3)(C#N)C4=CC=C(C=C4)F
١ مراجع
Imported from Wikidata item الإنجليزية
canonical SMILES الإنجليزية
CC1CN(CCC1(C2=CC=CC=C2)C(=O)O)C3CCC(CC3)(C#N)C4=CC=C(C=C4)F
١ مراجع
Imported from Wikidata item الإنجليزية
subclass of الإنجليزية
different from الإنجليزية