2-{4-[5-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-3-yl]piperidin-1-yl}-2-oxoethanol الإنجليزية (Q4565035)
مركب كيميائي
اللغة | التسمية | الوصف | أسماء أخرى |
---|---|---|---|
العربية | لم تُضف التسمية |
مركب كيميائي |
|
الإنجليزية | 2-{4-[5-(4-chlorophenyl)-4-pyrimidin-4-yl-1H-pyrazol-3-yl]piperidin-1-yl}-2-oxoethanol |
chemical compound |
|
بيانات
Wikidata item الإنجليزية
chemical formula الإنجليزية
canonical SMILES الإنجليزية
C1CN(CCC1C2=C(C(=NN2)C3=CC=C(C=C3)Cl)C4=NC=NC=C4)C(=O)CO
١ مراجع
Imported from Wikidata item الإنجليزية
instance of الإنجليزية
PDB structure ID الإنجليزية
mass الإنجليزية
DSSTox substance ID الإنجليزية
subclass of الإنجليزية
physically interacts with الإنجليزية
Mitogen-activated protein kinase 14 الإنجليزية
subject has role الإنجليزية
١ مراجع
Imported from Wikidata item الإنجليزية