(4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboximidic acid الإنجليزية (Q457162)
مركب كيميائي
اللغة | التسمية | الوصف | أسماء أخرى |
---|---|---|---|
العربية | لم تُضف التسمية |
مركب كيميائي |
|
الإنجليزية | (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboximidic acid |
chemical compound |
بيانات
Wikidata item الإنجليزية
chemical formula الإنجليزية
found in taxon الإنجليزية
instance of الإنجليزية
tautomer of الإنجليزية
mass الإنجليزية
subclass of الإنجليزية
isomeric SMILES الإنجليزية
CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)[C@@]2(O)C(O)=C3C(=O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12
١ مراجع
Imported from Wikidata item الإنجليزية
canonical SMILES الإنجليزية
CN(C)C1C(O)=C(C(N)=O)C(=O)C2(O)C(O)=C3C(=O)c4c(O)cccc4C(C)(O)C3CC12
١ مراجع
Imported from Wikidata item الإنجليزية